2-(4-t-Butylsulfamoylphenyl)nicotinic acid
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F637340 |
---|---|
Product Name | 2-(4-t-Butylsulfamoylphenyl)nicotinic acid |
CAS | 1261924-78-0 |
Purity | 96% |
Molecular weight | 334.39 |
IUPAC Name | 2-[4-(tert-butylsulfamoyl)phenyl]pyridine-3-carboxylic acid |
SMILES | CC(C)(C)NS(=O)(=O)C1=CC=C(C=C1)C1=C(C=CC=N1)C(O)=O |
INCHI Code | InChI=1S/C16H18N2O4S/c1-16(2,3)18-23(21,22)12-8-6-11(7-9-12)14-13(15(19)20)5-4-10-17-14/h4-10,18H,1-3H3,(H,19,20) |
Asymmetric atoms | 0 |
LogP | 1.4488473 |
H bond acceptors | 5 |
H bond donors | 2 |
fsp3 | 0.25 |
Concept Codes | Phenyl, Carboxylic acid, Heterocycle, Heteroaromatic, Sulfonamide, 6-Membered heteroaromatic, 6-Membered heterocycle, Pyridine, Cyclic, Aromatic |