4-(3-Acetylphenyl)-2-fluorobenzoic acid
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F637302 |
---|---|
Product Name | 4-(3-Acetylphenyl)-2-fluorobenzoic acid |
CAS | 1261906-36-8 |
Purity | 98% |
Molecular weight | 258.248 |
IUPAC Name | 3'-acetyl-3-fluoro-[1,1'-biphenyl]-4-carboxylic acid |
SMILES | CC(=O)C1=CC(=CC=C1)C1=CC=C(C(O)=O)C(F)=C1 |
INCHI Code | InChI=1S/C15H11FO3/c1-9(17)10-3-2-4-11(7-10)12-5-6-13(15(18)19)14(16)8-12/h2-8H,1H3,(H,18,19) |
Asymmetric atoms | 0 |
LogP | 2.9784036 |
H bond acceptors | 3 |
H bond donors | 1 |
fsp3 | 0.06666667 |
Concept Codes | Phenyl, Ketone, Carboxylic acid, Fluoro, Halo, Disubstituted (2,5)- monofluorobenzene, Monofluorobenzene, Cyclic, Aromatic, Acetophenone, Benzoic acid, Biphenyl |