1,1,3,3-Tetraethyl-1,3-dimethyldisiloxane
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F636309 |
---|---|
Product Name | 1,1,3,3-Tetraethyl-1,3-dimethyldisiloxane |
CAS | 1000-00-6 |
Purity | 98% |
Molecular weight | 218.487 |
IUPAC Name | {[diethyl(methyl)silyl]oxy}diethylmethylsilane |
SMILES | CC[Si](C)(CC)O[Si](C)(CC)CC |
INCHI Code | InChI=1S/C10H26OSi2/c1-7-12(5,8-2)11-13(6,9-3)10-4/h7-10H2,1-6H3 |
Asymmetric atoms | 0 |
LogP | 4.257 |
H bond acceptors | 1 |
H bond donors | 0 |
fsp3 | 1 |
Concept Codes | Organosilicon |