(3-Bromophenyl)(cyclopropylmethyl)sulfane
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F635719 |
---|---|
Product Name | (3-Bromophenyl)(cyclopropylmethyl)sulfane |
CAS | 1000576-47-5 |
Purity | 98% |
Molecular weight | 243.16 |
IUPAC Name | 1-bromo-3-[(cyclopropylmethyl)sulfanyl]benzene |
SMILES | BrC1=CC(SCC2CC2)=CC=C1 |
INCHI Code | InChI=1S/C10H11BrS/c11-9-2-1-3-10(6-9)12-7-8-4-5-8/h1-3,6,8H,4-5,7H2 |
Asymmetric atoms | 0 |
LogP | 4.0470147 |
H bond acceptors | 0 |
H bond donors | 0 |
fsp3 | 0.4 |
Concept Codes | Phenyl, Sulfide, Bromo, Halo, Monobromobenzene, Monosubstituted (meta) monobromobenzene, Cyclic, Aromatic, Cyclopropane |