(S)-4-Cyclohexyl-2-(2-(diphenylphosphanyl)phenyl)-4,5-dihydrooxazole
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F634288 |
---|---|
Product Name | (S)-4-Cyclohexyl-2-(2-(diphenylphosphanyl)phenyl)-4,5-dihydrooxazole |
CAS | 2634687-58-2 |
Purity | 98% |
Molecular weight | 413.501 |
IUPAC Name | (4S)-4-cyclohexyl-2-[2-(diphenylphosphanyl)phenyl]-4,5-dihydro-1,3-oxazole |
SMILES | C1OC(=N[C@H]1C1CCCCC1)C1=C(C=CC=C1)P(C1=CC=CC=C1)C1=CC=CC=C1 |
INCHI Code | InChI=1/C27H28NOP/c1-4-12-21(13-5-1)25-20-29-27(28-25)24-18-10-11-19-26(24)30(22-14-6-2-7-15-22)23-16-8-3-9-17-23/h2-3,6-11,14-19,21,25H,1,4-5,12-13,20H2/t25-/s2 |
Asymmetric atoms | 1 |
LogP | 6.7646 |
H bond acceptors | 2 |
H bond donors | 0 |
fsp3 | 0.2962963 |
Concept Codes | Phenyl, Ether, Heterocycle, Chiral, Phosphine, Cyclohexane, Cyclic, Aromatic, Oxazoline, Triphenylphosphine |