2,4,6-Trimethylthiophenol
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F633633 |
---|---|
Product Name | 2,4,6-Trimethylthiophenol |
CAS | 1541-10-2 |
Purity | 98% |
Molecular weight | 152.26 |
IUPAC Name | 2,4,6-trimethylbenzene-1-thiol |
SMILES | CC1=CC(C)=C(S)C(C)=C1 |
INCHI Code | InChI=1S/C9H12S/c1-6-4-7(2)9(10)8(3)5-6/h4-5,10H,1-3H3 |
Asymmetric atoms | 0 |
LogP | 3.606717 |
H bond acceptors | 0 |
H bond donors | 1 |
fsp3 | 0.33333334 |
Concept Codes | Phenyl, Methyl, Aromatic thiol, Tolyl, Cyclic, Aromatic |