(4-Methoxy-[1,1'-biphenyl]-2-yl)methanol
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F633261 |
---|---|
Product Name | (4-Methoxy-[1,1'-biphenyl]-2-yl)methanol |
CAS | 52008-92-1 |
Purity | 98% |
Molecular weight | 214.264 |
IUPAC Name | {4-methoxy-[1,1'-biphenyl]-2-yl}methanol |
SMILES | COC1=CC=C(C(CO)=C1)C1=CC=CC=C1 |
INCHI Code | InChI=1S/C14H14O2/c1-16-13-7-8-14(12(9-13)10-15)11-5-3-2-4-6-11/h2-9,15H,10H2,1H3 |
Asymmetric atoms | 0 |
LogP | 2.69545 |
H bond acceptors | 2 |
H bond donors | 1 |
fsp3 | 0.14285715 |
Concept Codes | Phenyl, Aliphatic alcohol, Methoxy, Ether, Cyclic, Aromatic, Anisole, Benzyl alcohol, Biphenyl |