1-(3-Phenylthiophen-2-yl)ethanone
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F632987 |
---|---|
Product Name | 1-(3-Phenylthiophen-2-yl)ethanone |
CAS | 26170-92-3 |
Purity | 98% |
Molecular weight | 202.27 |
IUPAC Name | 1-(3-phenylthiophen-2-yl)ethan-1-one |
SMILES | CC(=O)C1=C(C=CS1)C1=CC=CC=C1 |
INCHI Code | InChI=1S/C12H10OS/c1-9(13)12-11(7-8-14-12)10-5-3-2-4-6-10/h2-8H,1H3 |
Asymmetric atoms | 0 |
LogP | 3.091 |
H bond acceptors | 1 |
H bond donors | 0 |
fsp3 | 0.083333336 |
Concept Codes | Phenyl, Ketone, Heterocycle, Heteroaromatic, Sulfide, 5-Membered heteroaromatic, 5-Membered heterocycle, Thiophene, Cyclic, Aromatic |