2,4-Dibromo-6-fluorobenzoic acid
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F632673 |
---|---|
Product Name | 2,4-Dibromo-6-fluorobenzoic acid |
CAS | 183065-69-2 |
Purity | 97% |
Molecular weight | 297.905 |
IUPAC Name | 2,4-dibromo-6-fluorobenzoic acid |
SMILES | OC(=O)C1=C(Br)C=C(Br)C=C1F |
INCHI Code | InChI=1S/C7H3Br2FO2/c8-3-1-4(9)6(7(11)12)5(10)2-3/h1-2H,(H,11,12) |
Asymmetric atoms | 0 |
LogP | 3.3110359 |
H bond acceptors | 2 |
H bond donors | 1 |
fsp3 | 0.0 |
Concept Codes | Phenyl, Carboxylic acid, Fluoro, Bromo, Halo, 1,3-Dibromobenzene, Dibromobenzene, Monofluorobenzene, Trisubstituted (2,3,5)- monofluorobenzene, Cyclic, Aromatic, Benzoic acid |