3-Bromo-4-methylbiphenyl
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F632114 |
---|---|
Product Name | 3-Bromo-4-methylbiphenyl |
CAS | 855255-82-2 |
Purity | 98% |
Molecular weight | 247.135 |
IUPAC Name | 3-bromo-4-methyl-1,1'-biphenyl |
SMILES | CC1=C(Br)C=C(C=C1)C1=CC=CC=C1 |
INCHI Code | InChI=1S/C13H11Br/c1-10-7-8-12(9-13(10)14)11-5-3-2-4-6-11/h2-9H,1H3 |
Asymmetric atoms | 0 |
LogP | 4.902645 |
H bond acceptors | 0 |
H bond donors | 0 |
fsp3 | 0.07692308 |
Concept Codes | Phenyl, Bromo, Halo, Methyl, Tolyl, Disubstituted (2,5)- monobromobenzene, Monobromobenzene, Cyclic, Aromatic, Biphenyl |