Ethyl 4-(4-fluoro-3-methylthiophenyl)-6-methyl-2-oxo-1,2,3,4-tetrahydropyrimidine-5-carboxylate
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F631988 |
---|---|
Product Name | Ethyl 4-(4-fluoro-3-methylthiophenyl)-6-methyl-2-oxo-1,2,3,4-tetrahydropyrimidine-5-carboxylate |
CAS | 1809161-47-4 |
Purity | 95% |
Molecular weight | 324.37 |
IUPAC Name | ethyl 4-[4-fluoro-3-(methylsulfanyl)phenyl]-6-methyl-2-oxo-1,2,3,4-tetrahydropyrimidine-5-carboxylate |
SMILES | CCOC(=O)C1=C(C)NC(=O)NC1C1=CC(SC)=C(F)C=C1 |
INCHI Code | InChI=1/C15H17FN2O3S/c1-4-21-14(19)12-8(2)17-15(20)18-13(12)9-5-6-10(16)11(7-9)22-3/h5-7,13H,4H2,1-3H3,(H2,17,18,20) |
Asymmetric atoms | 1 |
LogP | 2.0112214 |
H bond acceptors | 2 |
H bond donors | 2 |
fsp3 | 0.33333334 |
Concept Codes | Phenyl, Ester, Heterocycle, Sulfide, Fluoro, Halo, Methyl, Lactam, Disubstituted (2,4)- monofluorobenzene, Monofluorobenzene, Cyclic, Aromatic |