2-(5-Chloro-2-(methylthio)phenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F627040 |
---|---|
Product Name | 2-(5-Chloro-2-(methylthio)phenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
CAS | 2060541-00-4 |
Purity | 98% |
Molecular weight | 284.61 |
IUPAC Name | 2-[5-chloro-2-(methylsulfanyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
SMILES | CSC1=CC=C(Cl)C=C1B1OC(C)(C)C(C)(C)O1 |
INCHI Code | InChI=1S/C13H18BClO2S/c1-12(2)13(3,4)17-14(16-12)10-8-9(15)6-7-11(10)18-5/h6-8H,1-5H3 |
Asymmetric atoms | 0 |
LogP | 5.0737 |
H bond acceptors | 2 |
H bond donors | 0 |
fsp3 | 0.53846157 |
Concept Codes | Phenyl, Sulfide, Chloro, Halo, Methyl, Boronic ester, Pinacol boronate, Disubstituted (3,4)- monochlorobenzene, Monochlorobenzene, Cyclic, Aromatic, Phenylboronic acid ester, Phenylboronic acid pinacol ester, 1,3,2-Dioxaborolane |