2-(4-Ethoxy-2-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F627019 |
---|---|
Product Name | 2-(4-Ethoxy-2-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
CAS | 1688679-44-8 |
Purity | 98% |
Molecular weight | 262.16 |
IUPAC Name | 2-(4-ethoxy-2-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
SMILES | CCOC1=CC=C(B2OC(C)(C)C(C)(C)O2)C(C)=C1 |
INCHI Code | InChI=1S/C15H23BO3/c1-7-17-12-8-9-13(11(2)10-12)16-18-14(3,4)15(5,6)19-16/h8-10H,7H2,1-6H3 |
Asymmetric atoms | 0 |
LogP | 4.4574 |
H bond acceptors | 3 |
H bond donors | 0 |
fsp3 | 0.6 |
Concept Codes | Phenyl, Ether, Methyl, Tolyl, Boronic ester, Pinacol boronate, Cyclic, Aromatic, Phenylboronic acid ester, Phenylboronic acid pinacol ester, 1,3,2-Dioxaborolane |