2-(3-Bromophenyl)azetidine hydrochloride
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F624951 |
---|---|
Product Name | 2-(3-Bromophenyl)azetidine hydrochloride |
CAS | 1461708-35-9 |
Purity | 98% |
Molecular weight | 248.55 |
IUPAC Name | 2-(3-bromophenyl)azetidine hydrochloride |
SMILES | Cl.BrC1=CC(=CC=C1)C1CCN1 |
INCHI Code | InChI=1/C9H10BrN.ClH/c10-8-3-1-2-7(6-8)9-4-5-11-9;/h1-3,6,9,11H,4-5H2;1H |
Asymmetric atoms | 1 |
LogP | 2.2485492 |
H bond acceptors | 1 |
H bond donors | 1 |
fsp3 | 0.33333334 |
Concept Codes | Phenyl, Heterocycle, Secondary amine, Amine (P+S+T), Bromo, Halo, Hydrochloride, 4-Membered heterocycle, Atezidine, Monobromobenzene, Monosubstituted (meta) monobromobenzene, Cyclic, Aromatic, Azetidine |