3-Fluoro-4-(4-methoxybenzylthio)phenylboronic acid
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F623551 |
---|---|
Product Name | 3-Fluoro-4-(4-methoxybenzylthio)phenylboronic acid |
CAS | 1072946-13-4 |
Purity | 98% |
Molecular weight | 292.13 |
IUPAC Name | (3-fluoro-4-{[(4-methoxyphenyl)methyl]sulfanyl}phenyl)boronic acid |
SMILES | COC1=CC=C(CSC2=CC=C(C=C2F)B(O)O)C=C1 |
INCHI Code | InChI=1S/C14H14BFO3S/c1-19-12-5-2-10(3-6-12)9-20-14-7-4-11(15(17)18)8-13(14)16/h2-8,17-18H,9H2,1H3 |
Asymmetric atoms | 0 |
LogP | 3.851 |
H bond acceptors | 3 |
H bond donors | 2 |
fsp3 | 0.14285715 |
Concept Codes | Phenyl, Methoxy, Ether, Sulfide, Fluoro, Halo, Boronic acid, Disubstituted (2,5)- monofluorobenzene, Monofluorobenzene, Cyclic, Aromatic, Anisole, Phenylboronic acid |