(3R,6R,7aS)-6-(Dibenzylamino)-3-phenyltetrahydro-3H,5H-pyrrolo[1,2-c]oxazol-5-one
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F616065 |
---|---|
Product Name | (3R,6R,7aS)-6-(Dibenzylamino)-3-phenyltetrahydro-3H,5H-pyrrolo[1,2-c]oxazol-5-one |
CAS | 1949843-82-6 |
Purity | 95% |
Molecular weight | 398.506 |
IUPAC Name | (3R,6R,7aS)-6-(dibenzylamino)-3-phenyl-hexahydropyrrolo[1,2-c][1,3]oxazol-5-one |
SMILES | [H][C@]12CO[C@@H](N1C(=O)[C@@H](C2)N(CC1=CC=CC=C1)CC1=CC=CC=C1)C1=CC=CC=C1 |
INCHI Code | InChI=1/C26H26N2O2/c29-25-24(16-23-19-30-26(28(23)25)22-14-8-3-9-15-22)27(17-20-10-4-1-5-11-20)18-21-12-6-2-7-13-21/h1-15,23-24,26H,16-19H2/t23-,24+,26+/s2 |
Asymmetric atoms | 3 |
LogP | 4.7495174 |
H bond acceptors | 3 |
H bond donors | 0 |
fsp3 | 0.26923078 |
Concept Codes | Phenyl, Ether, Heterocycle, Amide, Tertiary amine, Amine (P+S+T), Chiral, NBenzyl, 5-Membered heterocycle, Chiral amide, Chiral amine, Cyclic, Aromatic |