2-[Difluoro-(3,4,5-trifluorophenoxy)Methyl]-5-(4-ethylphenyl)-1,3-difluoro-benzene
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F614484 |
---|---|
Product Name | 2-[Difluoro-(3,4,5-trifluorophenoxy)Methyl]-5-(4-ethylphenyl)-1,3-difluoro-benzene |
Other Names | 4-[DIFLUORO(3,4,5-TRIFLUOROPHENOXY)METHYL]-4'-ETHYL-3,5-DIFLUOROBIPHENYL 4-(Difluoro(3,4,5-trifluorophenoxy)methyl)-4'-ethyl-3,5-difluoro-1,1'-biphenyl |
CAS | 303186-19-8 |
Purity | 97% |
Molecular weight | 414.323 |
IUPAC Name | 4-[difluoro(3,4,5-trifluorophenoxy)methyl]-4'-ethyl-3,5-difluoro-1,1'-biphenyl |
SMILES | CCC1=CC=C(C=C1)C1=CC(F)=C(C(F)=C1)C(F)(F)OC1=CC(F)=C(F)C(F)=C1 |
INCHI Code | InChI=1S/C21H13F7O/c1-2-11-3-5-12(6-4-11)13-7-15(22)19(16(23)8-13)21(27,28)29-14-9-17(24)20(26)18(25)10-14/h3-10H,2H2,1H3 |
Asymmetric atoms | 0 |
LogP | 7.7069116 |
H bond acceptors | 1 |
H bond donors | 0 |
fsp3 | 0.14285715 |
Concept Codes | Phenyl, Ether, Fluoro, Halo, Ethyl, 1,2,3-Trifluorobenzene, 1,3-Difluorobenzene, Difluorobenzene, Trifluorobenzene, Cyclic, Aromatic, Biphenyl, PFA02, PFA04 |