2-((1r,4r)-4-Hydroxycyclohexyl)acetonitrile
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F613416 |
---|---|
Product Name | 2-((1r,4r)-4-Hydroxycyclohexyl)acetonitrile |
CAS | 116941-24-3 |
Purity | 98% |
Molecular weight | 139.198 |
IUPAC Name | 2-[(1r,4r)-4-hydroxycyclohexyl]acetonitrile |
SMILES | O[C@H]1CC[C@H](CC#N)CC1 |
INCHI Code | InChI=1/C8H13NO/c9-6-5-7-1-3-8(10)4-2-7/h7-8,10H,1-5H2/t7-,8- |
Asymmetric atoms | 0 |
LogP | 0.7499883 |
H bond acceptors | 2 |
H bond donors | 1 |
fsp3 | 0.875 |
Concept Codes | Aliphatic alcohol, Nitrile, Chiral, Chiral alcohol, Cyclohexane, Cyclic |