Tetrakis(4-(pyridin-4-yl)phenyl)methane
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F612598 |
---|---|
Product Name | Tetrakis(4-(pyridin-4-yl)phenyl)methane |
CAS | 1319736-15-6 |
Purity | 98% |
Molecular weight | 628.779 |
IUPAC Name | 4-(4-{tris[4-(pyridin-4-yl)phenyl]methyl}phenyl)pyridine |
SMILES | C1=CC(=CC=N1)C1=CC=C(C=C1)C(C1=CC=C(C=C1)C1=CC=NC=C1)(C1=CC=C(C=C1)C1=CC=NC=C1)C1=CC=C(C=C1)C1=CC=NC=C1 |
INCHI Code | InChI=1S/C45H32N4/c1-9-41(10-2-33(1)37-17-25-46-26-18-37)45(42-11-3-34(4-12-42)38-19-27-47-28-20-38,43-13-5-35(6-14-43)39-21-29-48-30-22-39)44-15-7-36(8-16-44)40-23-31-49-32-24-40/h1-32H |
Asymmetric atoms | 0 |
LogP | 8.637926 |
H bond acceptors | 4 |
H bond donors | 0 |
fsp3 | 0.022222223 |
Concept Codes | Phenyl, Heterocycle, Heteroaromatic, 6-Membered heteroaromatic, 6-Membered heterocycle, Pyridine, Cyclic, Aromatic |