5-Chloro-6-(ethoxycarbonyl)nicotinic acid
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F611303 |
---|---|
Product Name | 5-Chloro-6-(ethoxycarbonyl)nicotinic acid |
CAS | 1198475-22-7 |
Purity | 95+% |
Molecular weight | 229.62 |
IUPAC Name | 5-chloro-6-(ethoxycarbonyl)pyridine-3-carboxylic acid |
SMILES | CCOC(=O)C1=C(Cl)C=C(C=N1)C(O)=O |
INCHI Code | InChI=1S/C9H8ClNO4/c1-2-15-9(14)7-6(10)3-5(4-11-7)8(12)13/h3-4H,2H2,1H3,(H,12,13) |
Asymmetric atoms | 0 |
LogP | 1.5633363 |
H bond acceptors | 4 |
H bond donors | 1 |
fsp3 | 0.22222222 |
Concept Codes | Halopyridine, Carboxylic acid, Ester, Heterocycle, Heteroaromatic, Chloro, Halo, 6-Membered heteroaromatic, 6-Membered heterocycle, Pyridine, Cyclic, Aromatic |