4-Chloro-2-methyl-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidine
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F610298 |
---|---|
Product Name | 4-Chloro-2-methyl-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidine |
CAS | 1196155-12-0 |
Purity | 98% |
Molecular weight | 183.64 |
IUPAC Name | 4-chloro-2-methyl-5H,6H,7H,8H-pyrido[3,4-d]pyrimidine |
SMILES | CC1=NC2=C(CCNC2)C(Cl)=N1 |
INCHI Code | InChI=1S/C8H10ClN3/c1-5-11-7-4-10-3-2-6(7)8(9)12-5/h10H,2-4H2,1H3 |
Asymmetric atoms | 0 |
LogP | 1.1273335 |
H bond acceptors | 3 |
H bond donors | 1 |
fsp3 | 0.5 |
Concept Codes | Heterocycle, Heteroaromatic, Secondary amine, Amine (P+S+T), Chloro, Halo, Methyl, 6-Membered heteroaromatic, 6-Membered heterocycle, Cyclic, Aromatic, 4-Chloropyrimidine, 4-Halopyrimidine |