Ethyl 2-(6-hydroxy-1-oxo-1,2,3,4-tetrahydronaphthalen-2-yl)acetate
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F610167 |
---|---|
Product Name | Ethyl 2-(6-hydroxy-1-oxo-1,2,3,4-tetrahydronaphthalen-2-yl)acetate |
CAS | 105806-38-0 |
Purity | 98% |
Molecular weight | 248.278 |
IUPAC Name | ethyl 2-(6-hydroxy-1-oxo-1,2,3,4-tetrahydronaphthalen-2-yl)acetate |
SMILES | CCOC(=O)CC1CCC2=CC(O)=CC=C2C1=O |
INCHI Code | InChI=1/C14H16O4/c1-2-18-13(16)8-10-4-3-9-7-11(15)5-6-12(9)14(10)17/h5-7,10,15H,2-4,8H2,1H3 |
Asymmetric atoms | 1 |
LogP | 2.1475744 |
H bond acceptors | 3 |
H bond donors | 1 |
fsp3 | 0.42857143 |
Concept Codes | Ketone, Ester, Aromatic alcohol, Cyclic, Aromatic, Tetralin |