7-Hydroxy-1,2,3,4-tetrahydro-8H-pyrido[1,2-a]pyrazin-8-one
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F608899 |
---|---|
Product Name | 7-Hydroxy-1,2,3,4-tetrahydro-8H-pyrido[1,2-a]pyrazin-8-one |
CAS | 1210687-36-7 |
Purity | 98% |
Molecular weight | 166.18 |
IUPAC Name | 7-hydroxy-1H,2H,3H,4H,8H-pyrido[1,2-a]pyrazin-8-one |
SMILES | OC1=CN2CCNCC2=CC1=O |
INCHI Code | InChI=1S/C8H10N2O2/c11-7-3-6-4-9-1-2-10(6)5-8(7)12/h3,5,9,12H,1-2,4H2 |
Asymmetric atoms | 0 |
LogP | -0.73428833 |
H bond acceptors | 4 |
H bond donors | 2 |
fsp3 | 0.375 |
Concept Codes | Heterocycle, Heteroaromatic, Secondary amine, Amine (P+S+T), Aromatic alcohol, 6-Membered heteroaromatic, 6-Membered heterocycle, Cyclic, Aromatic |