2-Phenylphthalazin-1(2H)-one
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F608721 |
---|---|
Product Name | 2-Phenylphthalazin-1(2H)-one |
Other Names | 2-phenyl-1,2-dihydrophthalazin-1-one |
CAS | 6266-49-5 |
Purity | 97% |
Molecular weight | 222.247 |
IUPAC Name | 2-phenyl-1,2-dihydrophthalazin-1-one |
SMILES | O=C1N(N=CC2=CC=CC=C12)C1=CC=CC=C1 |
INCHI Code | InChI=1S/C14H10N2O/c17-14-13-9-5-4-6-11(13)10-15-16(14)12-7-2-1-3-8-12/h1-10H |
Asymmetric atoms | 0 |
LogP | 2.8715234 |
H bond acceptors | 2 |
H bond donors | 0 |
fsp3 | 0.0 |
Concept Codes | Phenyl, Heterocycle, Heteroaromatic, 6-Membered heteroaromatic, 6-Membered heterocycle, Phthalazine, Cyclic, Aromatic |