2-((tert-Butoxycarbonyl)amino)-2-ethylbutanoic acid
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F606874 |
---|---|
Product Name | 2-((tert-Butoxycarbonyl)amino)-2-ethylbutanoic acid |
CAS | 139937-99-8 |
Purity | 97% |
Molecular weight | 231.292 |
IUPAC Name | 2-{[(tert-butoxy)carbonyl]amino}-2-ethylbutanoic acid |
SMILES | CCC(CC)(NC(=O)OC(C)(C)C)C(O)=O |
INCHI Code | InChI=1S/C11H21NO4/c1-6-11(7-2,8(13)14)12-9(15)16-10(3,4)5/h6-7H2,1-5H3,(H,12,15)(H,13,14) |
Asymmetric atoms | 0 |
LogP | 2.3911967 |
H bond acceptors | 3 |
H bond donors | 2 |
fsp3 | 0.8181818 |
Concept Codes | Carboxylic acid, Secondary amine, Amine (P+S+T), NBOC, Carbamate, Amino acid |