4-(3,4-Difluorophenylthio)butyl ethyl sulfide
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F542739 |
---|---|
Product Name | 4-(3,4-Difluorophenylthio)butyl ethyl sulfide |
Purity | 96.0% |
Molecular weight | 262.38 |
IUPAC Name | 4-{[4-(ethylsulfanyl)butyl]sulfanyl}-1,2-difluorobenzene |
SMILES | CCSCCCCSC1=CC=C(F)C(F)=C1 |
INCHI Code | InChI=1S/C12H16F2S2/c1-2-15-7-3-4-8-16-10-5-6-11(13)12(14)9-10/h5-6,9H,2-4,7-8H2,1H3 |
Asymmetric atoms | 0 |
LogP | 4.561718 |
H bond acceptors | 0 |
H bond donors | 0 |
fsp3 | 0.5 |
Concept Codes | Phenyl, Sulfide, Fluoro, Halo, 1,2-Difluorobenzene, Difluorobenzene, Cyclic, Aromatic |