(2,3-dimethyl-4-pyridinyl)boronic acid
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F541567 |
---|---|
Product Name | (2,3-dimethyl-4-pyridinyl)boronic acid |
CAS | 1246829-05-9 |
Purity | 95.0% |
Molecular weight | 150.97 |
IUPAC Name | (2,3-dimethylpyridin-4-yl)boronic acid |
SMILES | CC1=NC=CC(B(O)O)=C1C |
INCHI Code | InChI=1S/C7H10BNO2/c1-5-6(2)9-4-3-7(5)8(10)11/h3-4,10-11H,1-2H3 |
Asymmetric atoms | 0 |
LogP | 0.9657 |
H bond acceptors | 3 |
H bond donors | 2 |
fsp3 | 0.2857143 |
Concept Codes | Heterocycle, Heteroaromatic, Methyl, Boronic acid, Dimethyl, 6-Membered heteroaromatic, 6-Membered heterocycle, Pyridine, Cyclic, Aromatic |