N-[1-(furan-2-yl)ethyl]-2-nitroaniline
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F526952 |
---|---|
Product Name | N-[1-(furan-2-yl)ethyl]-2-nitroaniline |
Purity | 95.0% |
Molecular weight | 232.239 |
IUPAC Name | N-[1-(furan-2-yl)ethyl]-2-nitroaniline |
SMILES | CC(NC1=C(C=CC=C1)[N+]([O-])=O)C1=CC=CO1 |
INCHI Code | InChI=1/C12H12N2O3/c1-9(12-7-4-8-17-12)13-10-5-2-3-6-11(10)14(15)16/h2-9,13H,1H3 |
Asymmetric atoms | 1 |
LogP | 3.237303 |
H bond acceptors | 3 |
H bond donors | 1 |
fsp3 | 0.16666667 |
Concept Codes | Phenyl, Heterocycle, Heteroaromatic, Secondary amine, Amine (P+S+T), Nitro, 5-Membered heteroaromatic, 5-Membered heterocycle, Furan, Nitrobenzene, Cyclic, Aromatic |