5-chloro-3-[(2-methoxyethyl)sulfanyl]-1,2,4-thiadiazole
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F525873 |
---|---|
Product Name | 5-chloro-3-[(2-methoxyethyl)sulfanyl]-1,2,4-thiadiazole |
CAS | 1326813-13-1 |
Purity | 95.0% |
Molecular weight | 210.69 |
IUPAC Name | 5-chloro-3-[(2-methoxyethyl)sulfanyl]-1,2,4-thiadiazole |
SMILES | COCCSC1=NSC(Cl)=N1 |
INCHI Code | InChI=1S/C5H7ClN2OS2/c1-9-2-3-10-5-7-4(6)11-8-5/h2-3H2,1H3 |
Asymmetric atoms | 0 |
LogP | 2.2474012 |
H bond acceptors | 3 |
H bond donors | 0 |
fsp3 | 0.6 |
Concept Codes | Methoxy, Ether, Heterocycle, Heteroaromatic, Sulfide, Chloro, Halo, 5-Membered heteroaromatic, 5-Membered heterocycle, Cyclic, Aromatic, 1,2,4-Thiadiazole, Thiadiazole |