2-methyl-1-undecylpiperazine
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F525140 |
---|---|
Product Name | 2-methyl-1-undecylpiperazine |
CAS | 1240571-83-8 |
Purity | 95.0% |
Molecular weight | 254.462 |
IUPAC Name | 2-methyl-1-undecylpiperazine |
SMILES | CCCCCCCCCCCN1CCNCC1C |
INCHI Code | InChI=1/C16H34N2/c1-3-4-5-6-7-8-9-10-11-13-18-14-12-17-15-16(18)2/h16-17H,3-15H2,1-2H3 |
Asymmetric atoms | 1 |
LogP | 4.5066957 |
H bond acceptors | 2 |
H bond donors | 1 |
fsp3 | 1 |
Concept Codes | Heterocycle, Secondary amine, Tertiary amine, Amine (P+S+T), Methyl, Diamine, 6-Membered heterocycle, Piperazine, Cyclic |