4-(3,4-dimethylphenyl)-6-(4-fluorophenyl)pyrimidin-2-amine
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F524836 |
---|---|
Product Name | 4-(3,4-dimethylphenyl)-6-(4-fluorophenyl)pyrimidin-2-amine |
CAS | 1354927-03-9 |
Purity | 95.0% |
Molecular weight | 293.345 |
IUPAC Name | 4-(3,4-dimethylphenyl)-6-(4-fluorophenyl)pyrimidin-2-amine |
SMILES | CC1=C(C)C=C(C=C1)C1=CC(=NC(N)=N1)C1=CC=C(F)C=C1 |
INCHI Code | InChI=1S/C18H16FN3/c1-11-3-4-14(9-12(11)2)17-10-16(21-18(20)22-17)13-5-7-15(19)8-6-13/h3-10H,1-2H3,(H2,20,21,22) |
Asymmetric atoms | 0 |
LogP | 5.1352916 |
H bond acceptors | 3 |
H bond donors | 1 |
fsp3 | 0.11111111 |
Concept Codes | Phenyl, Heterocycle, Heteroaromatic, Primary amine, Amine (P+S+T), Fluoro, Halo, Methyl, Tolyl, Dimethyl, 6-Membered heteroaromatic, 6-Membered heterocycle, Monofluorobenzene, Monosubstituted (para) monofluorobenzene, Pyrimidine, Cyclic, Aromatic |