(2E)-1-(2-methoxyphenyl)-3-(2,3,4-trimethoxyphenyl)prop-2-en-1-one
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F524210 |
---|---|
Product Name | (2E)-1-(2-methoxyphenyl)-3-(2,3,4-trimethoxyphenyl)prop-2-en-1-one |
Purity | 95.0% |
Molecular weight | 328.364 |
IUPAC Name | (2E)-1-(2-methoxyphenyl)-3-(2,3,4-trimethoxyphenyl)prop-2-en-1-one |
SMILES | COC1=CC=C(\C=C\C(=O)C2=C(OC)C=CC=C2)C(OC)=C1OC |
INCHI Code | InChI=1S/C19H20O5/c1-21-16-8-6-5-7-14(16)15(20)11-9-13-10-12-17(22-2)19(24-4)18(13)23-3/h5-12H,1-4H3/b11-9+ |
Asymmetric atoms | 0 |
LogP | 3.2596402 |
H bond acceptors | 5 |
H bond donors | 0 |
fsp3 | 0.21052632 |
Concept Codes | Phenyl, Ketone, Methoxy, Ether, Alkene, Cyclic, Aromatic, Anisole |