(2E)-1-(3,4-dichlorophenyl)-3-(5-methylthiophen-2-yl)prop-2-en-1-one
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F524064 |
---|---|
Product Name | (2E)-1-(3,4-dichlorophenyl)-3-(5-methylthiophen-2-yl)prop-2-en-1-one |
CAS | 92153-05-4 |
Purity | 95.0% |
Molecular weight | 297.19 |
IUPAC Name | (2E)-1-(3,4-dichlorophenyl)-3-(5-methylthiophen-2-yl)prop-2-en-1-one |
SMILES | CC1=CC=C(S1)\C=C\C(=O)C1=CC(Cl)=C(Cl)C=C1 |
INCHI Code | InChI=1S/C14H10Cl2OS/c1-9-2-4-11(18-9)5-7-14(17)10-3-6-12(15)13(16)8-10/h2-8H,1H3/b7-5+ |
Asymmetric atoms | 0 |
LogP | 5.657157 |
H bond acceptors | 1 |
H bond donors | 0 |
fsp3 | 0.071428575 |
Concept Codes | Phenyl, Ketone, Heterocycle, Heteroaromatic, Sulfide, Chloro, Halo, Methyl, Alkene, 1,2-Dichlorobenzene, 5-Membered heteroaromatic, 5-Membered heterocycle, Dichlorobenzene, Thiophene, Cyclic, Aromatic |