tert-butyl 3-[(3-methoxypropyl)amino]-2-methylpropanoate
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F522822 |
---|---|
Product Name | tert-butyl 3-[(3-methoxypropyl)amino]-2-methylpropanoate |
CAS | 1221346-40-2 |
Purity | 95.0% |
Molecular weight | 231.336 |
IUPAC Name | tert-butyl 3-[(3-methoxypropyl)amino]-2-methylpropanoate |
SMILES | COCCCNCC(C)C(=O)OC(C)(C)C |
INCHI Code | InChI=1/C12H25NO3/c1-10(9-13-7-6-8-15-5)11(14)16-12(2,3)4/h10,13H,6-9H2,1-5H3 |
Asymmetric atoms | 1 |
LogP | 1.2779418 |
H bond acceptors | 3 |
H bond donors | 1 |
fsp3 | 0.9166667 |
Concept Codes | Ester, Methoxy, Ether, Secondary amine, Amine (P+S+T), Amino acid ester, Beta-amino acid |