N-ethyl-N-[(oxiran-2-yl)methyl]cyclohexanamine
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F522615 |
---|---|
Product Name | N-ethyl-N-[(oxiran-2-yl)methyl]cyclohexanamine |
CAS | 954580-79-1 |
Purity | 95.0% |
Molecular weight | 183.295 |
IUPAC Name | N-ethyl-N-[(oxiran-2-yl)methyl]cyclohexanamine |
SMILES | CCN(CC1CO1)C1CCCCC1 |
INCHI Code | InChI=1/C11H21NO/c1-2-12(8-11-9-13-11)10-6-4-3-5-7-10/h10-11H,2-9H2,1H3 |
Asymmetric atoms | 1 |
LogP | 2.1875145 |
H bond acceptors | 2 |
H bond donors | 0 |
fsp3 | 1 |
Concept Codes | Ether, Heterocycle, Tertiary amine, Amine (P+S+T), 3-Membered heterocycle, Oxirane, Cyclohexane, Cyclic |