benzyl 3-fluoro-4,4-dihydroxypiperidine-1-carboxylate
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F519071 |
---|---|
Product Name | benzyl 3-fluoro-4,4-dihydroxypiperidine-1-carboxylate |
CAS | 2102412-10-0 |
Purity | 97.0% |
Molecular weight | 269.272 |
IUPAC Name | benzyl 3-fluoro-4,4-dihydroxypiperidine-1-carboxylate |
SMILES | OC1(O)CCN(CC1F)C(=O)OCC1=CC=CC=C1 |
INCHI Code | InChI=1/C13H16FNO4/c14-11-8-15(7-6-13(11,17)18)12(16)19-9-10-4-2-1-3-5-10/h1-5,11,17-18H,6-9H2 |
Asymmetric atoms | 1 |
LogP | 1.3003441 |
H bond acceptors | 3 |
H bond donors | 2 |
fsp3 | 0.46153846 |
Concept Codes | Phenyl, Aliphatic alcohol, Heterocycle, Fluoro, Halo, NCbz, 6-Membered heterocycle, Piperidine, Cyclic, Aromatic, O-Benzyl |