4-chloro-1-ethyl-3-[(2,2,2-trifluoroethoxy)methyl]-1H-pyrazole
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F509927 |
---|---|
Product Name | 4-chloro-1-ethyl-3-[(2,2,2-trifluoroethoxy)methyl]-1H-pyrazole |
Molecular weight | 242.63 |
IUPAC Name | 4-chloro-1-ethyl-3-[(2,2,2-trifluoroethoxy)methyl]-1H-pyrazole |
SMILES | CCN1C=C(Cl)C(COCC(F)(F)F)=N1 |
INCHI Code | InChI=1S/C8H10ClF3N2O/c1-2-14-3-6(9)7(13-14)4-15-5-8(10,11)12/h3H,2,4-5H2,1H3 |
Asymmetric atoms | 0 |
LogP | 2.2743034 |
H bond acceptors | 2 |
H bond donors | 0 |
fsp3 | 0.625 |
Concept Codes | Ether, Heterocycle, Heteroaromatic, Fluoro, Chloro, Halo, Trifluoromethyl, 5-Membered heteroaromatic, 5-Membered heterocycle, Pyrazole, Cyclic, Aromatic, PFA01, PFA02 |