7-CHLORO-2-METHYL-FURO[3,2-B]PYRIDINE
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F502515 |
---|---|
Product Name | 7-CHLORO-2-METHYL-FURO[3,2-B]PYRIDINE |
Other Names | 7-Chloro-2-methylfuro[3,2-b]pyridine |
CAS | 220992-40-5 |
Purity | 95.0% |
Molecular weight | 167.59 |
IUPAC Name | 7-chloro-2-methylfuro[3,2-b]pyridine |
SMILES | CC1=CC2=NC=CC(Cl)=C2O1 |
INCHI Code | InChI=1S/C8H6ClNO/c1-5-4-7-8(11-5)6(9)2-3-10-7/h2-4H,1H3 |
Asymmetric atoms | 0 |
LogP | 2.1041532 |
H bond acceptors | 1 |
H bond donors | 0 |
fsp3 | 0.125 |
Concept Codes | Halopyridine, Heterocycle, Heteroaromatic, Chloro, Halo, Methyl, 5-Membered heteroaromatic, 5-Membered heterocycle, 6-Membered heteroaromatic, 6-Membered heterocycle, Cyclic, Aromatic, 4-Chloropyridine, 4-Halopyridine |