4-Amino-2-methylbenzoic acid ethyl ester
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F494237 |
---|---|
Product Name | 4-Amino-2-methylbenzoic acid ethyl ester |
CAS | 74450-59-2 |
Purity | 99.0% |
Molecular weight | 179.219 |
IUPAC Name | ethyl 4-amino-2-methylbenzoate |
SMILES | CCOC(=O)C1=C(C)C=C(N)C=C1 |
INCHI Code | InChI=1S/C10H13NO2/c1-3-13-10(12)9-5-4-8(11)6-7(9)2/h4-6H,3,11H2,1-2H3 |
Asymmetric atoms | 0 |
LogP | 2.018026 |
H bond acceptors | 2 |
H bond donors | 1 |
fsp3 | 0.3 |
Concept Codes | Phenyl, Ester, Primary amine, Amine (P+S+T), Methyl, Tolyl, Amino acid ester, Aniline, Cyclic, Aromatic, Benzoate |