2-(Di-n-butylamino)ethylamine
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F493736 |
---|---|
Product Name | 2-(Di-n-butylamino)ethylamine |
Other Names | N,N-Di-n-butylethylenediamine N,N-Dibutylethylenediamine |
CAS | 3529-09-7 |
Purity | 98.0% |
Molecular weight | 172.316 |
IUPAC Name | (2-aminoethyl)dibutylamine |
SMILES | CCCCN(CCN)CCCC |
INCHI Code | InChI=1S/C10H24N2/c1-3-5-8-12(10-7-11)9-6-4-2/h3-11H2,1-2H3 |
Asymmetric atoms | 0 |
LogP | 2.0409837 |
H bond acceptors | 2 |
H bond donors | 1 |
fsp3 | 1 |
Concept Codes | Primary amine, Tertiary amine, Amine (P+S+T), Diamine |