Boc-b-cyclohexyl-L-alanine methyl ester
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F493297 |
---|---|
Product Name | Boc-b-cyclohexyl-L-alanine methyl ester |
Other Names | Boc-Cha-OMe |
CAS | 98105-41-0 |
Purity | 95.0% |
Molecular weight | 285.384 |
IUPAC Name | methyl (2S)-2-{[(tert-butoxy)carbonyl]amino}-3-cyclohexylpropanoate |
SMILES | COC(=O)[C@H](CC1CCCCC1)NC(=O)OC(C)(C)C |
INCHI Code | InChI=1S/C15H27NO4/c1-15(2,3)20-14(18)16-12(13(17)19-4)10-11-8-6-5-7-9-11/h11-12H,5-10H2,1-4H3,(H,16,18)/t12-/m0/s1 |
Asymmetric atoms | 1 |
LogP | 3.1833704 |
H bond acceptors | 2 |
H bond donors | 1 |
fsp3 | 0.8666667 |
Concept Codes | Ester, Secondary amine, Amine (P+S+T), Chiral, NBOC, Carbamate, Amino acid ester, Chiral ester, Cyclohexane, Cyclic, Alpha-amino acid |