5-Bromo-2-isobutoxypyrimidine
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F476450 |
---|---|
Product Name | 5-Bromo-2-isobutoxypyrimidine |
Molecular weight | 231.093 |
IUPAC Name | 5-bromo-2-(2-methylpropoxy)pyrimidine |
SMILES | CC(C)COC1=NC=C(Br)C=N1 |
INCHI Code | InChI=1S/C8H11BrN2O/c1-6(2)5-12-8-10-3-7(9)4-11-8/h3-4,6H,5H2,1-2H3 |
Asymmetric atoms | 0 |
LogP | 2.583906 |
H bond acceptors | 3 |
H bond donors | 0 |
fsp3 | 0.5 |
Concept Codes | Ether, Heterocycle, Heteroaromatic, Bromo, Halo, 6-Membered heteroaromatic, 6-Membered heterocycle, Pyrimidine, Cyclic, Aromatic |