(2-Amino-4-cyanophenyl)boronic acid hydrochloride
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F431430 |
---|---|
Product Name | (2-Amino-4-cyanophenyl)boronic acid hydrochloride |
CAS | 850568-47-7 |
Purity | 97.0% |
Molecular weight | 198.41 |
IUPAC Name | (2-amino-4-cyanophenyl)boronic acid hydrochloride |
SMILES | Cl.NC1=C(C=CC(=C1)C#N)B(O)O |
INCHI Code | InChI=1S/C7H7BN2O2.ClH/c9-4-5-1-2-6(8(11)12)7(10)3-5;/h1-3,11-12H,10H2;1H |
Asymmetric atoms | 0 |
LogP | 0.6716 |
H bond acceptors | 4 |
H bond donors | 3 |
fsp3 | 0.0 |
Concept Codes | Phenyl, Primary amine, Amine (P+S+T), Nitrile, Hydrochloride, Boronic acid, Aniline, Cyclic, Aromatic, Benzonitrile, Phenylboronic acid |