2-(Dihydro-2H-pyran-4(3H)-ylidene)malononitrile
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F431168 |
---|---|
Product Name | 2-(Dihydro-2H-pyran-4(3H)-ylidene)malononitrile |
Other Names | 2-(2H-Pyran-4(3H,5H,6H)-ylidene)-malononitrile |
CAS | 62702-83-4 |
Purity | 95.0% |
Molecular weight | 148.165 |
IUPAC Name | 2-(oxan-4-ylidene)propanedinitrile |
SMILES | N#CC(C#N)=C1CCOCC1 |
INCHI Code | InChI=1S/C8H8N2O/c9-5-8(6-10)7-1-3-11-4-2-7/h1-4H2 |
Asymmetric atoms | 0 |
LogP | 0.3769014 |
H bond acceptors | 3 |
H bond donors | 0 |
fsp3 | 0.5 |
Concept Codes | Ether, Heterocycle, Nitrile, 6-Membered heterocycle, Tetrahydro-2H-pyran, Cyclic |