N-(4-oxo-2-thioxo-1,3-thiazolidin-3-yl)-N'-phenylurea
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F426354 |
---|---|
Product Name | N-(4-oxo-2-thioxo-1,3-thiazolidin-3-yl)-N'-phenylurea |
Other Names | 1-(4-Oxo-2-thioxothiazolidin-3-yl)-3-phenylurea |
CAS | 13238-64-7 |
Molecular weight | 267.32 |
IUPAC Name | 3-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)-1-phenylurea |
SMILES | O=C(NN1C(=O)CSC1=S)NC1=CC=CC=C1 |
INCHI Code | InChI=1S/C10H9N3O2S2/c14-8-6-17-10(16)13(8)12-9(15)11-7-4-2-1-3-5-7/h1-5H,6H2,(H2,11,12,15) |
Asymmetric atoms | 0 |
LogP | 1.930355 |
H bond acceptors | 2 |
H bond donors | 2 |
fsp3 | 0.1 |
Concept Codes | Phenyl, Heterocycle, Sulfide, Lactam, 5-Membered heterocycle, Cyclic, Aromatic, Thiazolane |