2'-iso-Propoxybutyrophenone
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F396237 |
---|---|
Product Name | 2'-iso-Propoxybutyrophenone |
Other Names | 1-(2-Isopropoxy-phenyl)-butan-1-one 1-(2-Isopropoxyphenyl)butan-1-one |
CAS | 1443307-39-8 |
Purity | 97.0% |
Molecular weight | 206.285 |
IUPAC Name | 1-[2-(propan-2-yloxy)phenyl]butan-1-one |
SMILES | CCCC(=O)C1=CC=CC=C1OC(C)C |
INCHI Code | InChI=1S/C13H18O2/c1-4-7-12(14)11-8-5-6-9-13(11)15-10(2)3/h5-6,8-10H,4,7H2,1-3H3 |
Asymmetric atoms | 0 |
LogP | 3.2917097 |
H bond acceptors | 2 |
H bond donors | 0 |
fsp3 | 0.46153846 |
Concept Codes | Phenyl, Ketone, Ether, Cyclic, Aromatic |