Ethyl (4-chloro-3-methylbenzoyl)acetate
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F394195 |
---|---|
Product Name | Ethyl (4-chloro-3-methylbenzoyl)acetate |
CAS | 430535-14-1 |
Purity | 97.0% |
Molecular weight | 240.68 |
IUPAC Name | ethyl 3-(4-chloro-3-methylphenyl)-3-oxopropanoate |
SMILES | CCOC(=O)CC(=O)C1=CC(C)=C(Cl)C=C1 |
INCHI Code | InChI=1S/C12H13ClO3/c1-3-16-12(15)7-11(14)9-4-5-10(13)8(2)6-9/h4-6H,3,7H2,1-2H3 |
Asymmetric atoms | 0 |
LogP | 3.04329 |
H bond acceptors | 2 |
H bond donors | 0 |
fsp3 | 0.33333334 |
Concept Codes | Phenyl, Ketone, Ester, Chloro, Halo, Methyl, Tolyl, Disubstituted (2,4)- monochlorobenzene, Monochlorobenzene, Cyclic, Aromatic |