1,3-Difluoro-5-[(3,4-difluorophenyl)sulfanylmethyl]benzene
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F392843 |
---|---|
Product Name | 1,3-Difluoro-5-[(3,4-difluorophenyl)sulfanylmethyl]benzene |
Other Names | (3,5-Difluorobenzyl)(3,4-difluorophenyl)sulfane |
CAS | 1443344-51-1 |
Purity | 97.0% |
Molecular weight | 272.26 |
IUPAC Name | 4-{[(3,5-difluorophenyl)methyl]sulfanyl}-1,2-difluorobenzene |
SMILES | FC1=CC(CSC2=CC(F)=C(F)C=C2)=CC(F)=C1 |
INCHI Code | InChI=1S/C13H8F4S/c14-9-3-8(4-10(15)5-9)7-18-11-1-2-12(16)13(17)6-11/h1-6H,7H2 |
Asymmetric atoms | 0 |
LogP | 4.792966 |
H bond acceptors | 0 |
H bond donors | 0 |
fsp3 | 0.07692308 |
Concept Codes | Phenyl, Sulfide, Fluoro, Halo, 1,2-Difluorobenzene, 1,3-Difluorobenzene, Difluorobenzene, Cyclic, Aromatic |