3-(5-Methoxybenzo[d]oxazol-2-yl)-2-methylaniline
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F392561 |
---|---|
Product Name | 3-(5-Methoxybenzo[d]oxazol-2-yl)-2-methylaniline |
Other Names | [3-(5-methoxy-1,3-benzoxazol-2-yl)-2-methylphenyl]amine |
CAS | 875000-02-5 |
Purity | 95.0% |
Molecular weight | 254.289 |
IUPAC Name | 3-(5-methoxy-1,3-benzoxazol-2-yl)-2-methylaniline |
SMILES | COC1=CC=C2OC(=NC2=C1)C1=C(C)C(N)=CC=C1 |
INCHI Code | InChI=1S/C15H14N2O2/c1-9-11(4-3-5-12(9)16)15-17-13-8-10(18-2)6-7-14(13)19-15/h3-8H,16H2,1-2H3 |
Asymmetric atoms | 0 |
LogP | 2.8714597 |
H bond acceptors | 3 |
H bond donors | 1 |
fsp3 | 0.13333334 |
Concept Codes | Phenyl, Methoxy, Ether, Heterocycle, Heteroaromatic, Primary amine, Amine (P+S+T), Methyl, Tolyl, 5-Membered heteroaromatic, 5-Membered heterocycle, Benzoxazole, Aniline, Cyclic, Aromatic |