N-(4-amino-2-methoxyphenyl)-2-methylpropanamide
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F392127 |
---|---|
Product Name | N-(4-amino-2-methoxyphenyl)-2-methylpropanamide |
CAS | 532417-07-5 |
Purity | 95.0% |
Molecular weight | 208.261 |
IUPAC Name | N-(4-amino-2-methoxyphenyl)-2-methylpropanamide |
SMILES | COC1=C(NC(=O)C(C)C)C=CC(N)=C1 |
INCHI Code | InChI=1S/C11H16N2O2/c1-7(2)11(14)13-9-5-4-8(12)6-10(9)15-3/h4-7H,12H2,1-3H3,(H,13,14) |
Asymmetric atoms | 0 |
LogP | 1.4678811 |
H bond acceptors | 3 |
H bond donors | 2 |
fsp3 | 0.36363637 |
Concept Codes | Phenyl, Methoxy, Ether, Amide, Primary amine, Amine (P+S+T), Aniline, Cyclic, Aromatic, Anisole |